CDP-DG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z))
Formula: C48H79N3O15P2 (999.4986)
Chinese Name:
BioDeep ID: BioDeep_00000108334
( View LC/MS Profile)
SMILES: [H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/C\C=C/CC)(COP(O)(=O)OP(O)(=O)OC[C@H]1O[C@H](C(O)[C@H]1O)N1C=CC(N)=NC1=O)OC(=O)CCCCCCC\C=C/C\C=C/CCCCC
Found 16 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
964.4853 | [M+H-2H2O]+PPM:0.6 |
Rattus norvegicus | Brain | MALDI (CHCA) |
Spectroswiss - sol_2x_br_2 - 2016-09-29_07h40m45sResolution: 17μm, 488x193
|
|
999.523 | [M-H2O+NH4]+PPM:1.1 |
Rattus norvegicus | Brain | MALDI (CHCA) |
Spectroswiss - sol_2x_br_2 - 2016-09-29_07h40m45sResolution: 17μm, 488x193
|
|
964.4758 | [M+H-2H2O]+PPM:9.3 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
982.4928 | [M+H-H2O]+PPM:2.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
982.5041 | [M+H-H2O]+PPM:8.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
982.5037 | [M+H-H2O]+PPM:8.5 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
964.4787 | [M+H-2H2O]+PPM:6.3 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
1038.6047 | [M+K]+PPM:8 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
1000.5233 | [M+H]+PPM:17.4 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
964.4767 | [M+H-2H2O]+PPM:8.4 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
1000.5237 | [M+H]+PPM:17.8 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
964.4796 | [M+H-2H2O]+PPM:5.4 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
1038.6053 | [M+K]+PPM:8.6 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
964.4798 | [M+H-2H2O]+PPM:5.1 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
964.4797 | [M+H-2H2O]+PPM:5.2 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
1038.6046 | [M+K]+PPM:7.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
CDP-DG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)) is a cytidine diphosphate diacylglycerol or CDP-diacylglycerol (CDP-DG). CDP-diacylglycerol is an important branchpoint intermediate in eukaryotic phospholipid biosynthesis and could be a key regulatory molecule in phospholipid metabolism. It is a glycerophospholipid in which a cytidine diphosphate moiety occupies a glycerol substitution site. As is the case with diacylglycerols, CDP-diacylglycerols can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. Fatty acids containing 16, 18 and 20 carbons are the most common. CDP-DG(18:3(9Z,12Z,15Z)/18:2(9Z,12Z)), in particular, consists of one chain of alpha-linolenic acid at the C-1 position and one chain of linoleic acid at the C-2 position. Cytidine diphosphate diacylglycerols are rarely noticed in analyses of lipid compositions of tissues, as they are present is such small amounts (perhaps only 0.05\\% or so of the total phospholipids).