Ergovaline
Formula: C29H35N5O5 (533.2638)
Chinese Name:
BioDeep ID: BioDeep_00000178784
( View LC/MS Profile)
SMILES: CC(C)C1C(=O)N2CCCC2C3(N1C(=O)C(O3)(C)NC(=O)C4CN(C5CC6=CNC7=CC=CC(=C67)C5=C4)C)O
Found 16 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 534.276 | [M+H]+PPM:9.2 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
| 534.2785 | [M+H]+PPM:13.9 |
Bathymodiolus | epithelial host cells | MALDI (DHB) |
MPIBremen_Bputeoserpentis_MALDI-FISH_DHB_233x233pixel_3um_mz400-1200_240k@200 - MTBLS744Resolution: 3μm, 233x233
The Bathymodiolus puteoserpentis specimen used for high resolution AP-MALDI-MSI was collected during the RV Meteor M126 cruise in 2016 at the Logatchev hydrothermal vent field on the Mid-Atlantic Ridge. The specimen was retrieved with the MARUM-Quest remotely operated vehicle (ROV) at the Irina II vent site at 3038 m depth, 14°45’11.01”N and 44°58’43.98”W, and placed in an insulated container to prevent temperature changes during recovery. Gills were dissected from the mussel as soon as brought on board after ROV retrieval, submerged in precooled 2% w/v carboxymethyl cellulose gel (CMC, Mw ~ 700,000, Sigma-Aldrich Chemie GmbH) and snap-frozen in liquid N2. Samples were stored at -80 °C until use.
|
|
| 534.2785 | [M+H]+PPM:13.9 |
Bathymodiolus | epithelial host cells | MALDI (DHB) |
MPIMM_054_QE_P_BP_CF_Bputeoserpentis_MALDI-FISH8_Sl16_s1_DHB_233x233_3um - MTBLS744Resolution: 3μm, 233x233
|
|
| 534.2786 | [M+H]+PPM:14.1 |
Bathymodiolus | epithelial host cells | MALDI (DHB) |
MPIMM_039_QE_P_BP_CF_Bputeoserpentis_MALDI-FISH8_Sl14_s1_DHB_233x233_3um - MTBLS744Resolution: 3μm, 233x234
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_46 - MTBLS58Resolution: 17μm, 298x106
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 534.2675 | [M+H]+PPM:6.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
| 551.2939 | [M+NH4]+PPM:6.8 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
| 534.2674 | [M+H]+PPM:6.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_06 - MTBLS58Resolution: 17μm, 183x103
|
|
| 534.2675 | [M+H]+PPM:6.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 534.2791 | [M+H]+PPM:15 |
Mus musculus | Left upper arm | MALDI (CHCA) |
357_l_total ion count - Limb defect imaging - Monash UniversityResolution: 50μm, 97x131
Diseased |
|
