8-Acetoxypinoresinol 4-glucoside
Formula: C28H34O13 (578.1999)
Chinese Name:
BioDeep ID: BioDeep_00000022017
( View LC/MS Profile)
SMILES: CC(=O)OC12COC(C1COC2C3=CC(=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)OC)C5=CC(=C(C=C5)O)OC
Found 9 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
578.2159 | [M-H2O+NH4]+PPM:12.6 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
579.2082 | [M+H]+PPM:1.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
579.2082 | [M+H]+PPM:1.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
579.2083 | [M+H]+PPM:1.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_47 - MTBLS58Resolution: 17μm, 301x111
|
|
579.2082 | [M+H]+PPM:1.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
579.2082 | [M+H]+PPM:1.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
579.2082 | [M+H]+PPM:1.7 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
579.2076 | [M+H]+PPM:0.7 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
579.2075 | [M+H]+PPM:0.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
8-Acetoxypinoresinol 4-glucoside is found in pomes. 8-Acetoxypinoresinol 4-glucoside is a constituent of bark of Olea europaea (olive). Constituent of bark of Olea europaea (olive). 8-Acetoxypinoresinol 4-glucoside is found in pomes.