6,23-dibromo-7,11,13,16,18,22-hexahydroxy-5-(2-hydroxypentyl)-24-(2-hydroxypropyl)octacyclo[13.11.1.1²,¹⁰.0³,⁸.0⁴,²⁵.0¹⁹,²⁷.0²¹,²⁶.0¹⁴,²⁸]octacosa-1,3,5,7,10(28),11,13,15(27),16,18,21(26),22,24-tridecaene-9,20-dione
Formula: C36H26Br2O10 (775.9893)
Chinese Name:
BioDeep ID: BioDeep_00002134047
( View LC/MS Profile)
SMILES: CCCC(O)Cc1c(Br)c(O)c2c(=O)c3c(O)cc(O)c4c5c(O)cc(O)c6c(=O)c7c(O)c(Br)c(CC(C)O)c8c1c2c(c34)c(c65)c78
Found 16 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
776.0101 | [M-H2O+NH4]+PPM:3.1 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
794.0229 | [M+NH4]+PPM:0.2 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
758.9739 | [M+H-H2O]+PPM:15.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
776.0136 | [M-H2O+NH4]+PPM:1.4 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
777.0081 | [M+H]+PPM:14.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
794.0353 | [M+NH4]+PPM:15.4 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
758.9723 | [M+H-H2O]+PPM:18 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
776.0129 | [M-H2O+NH4]+PPM:0.5 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
777.0074 | [M+H]+PPM:14 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
794.0346 | [M+NH4]+PPM:14.5 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
740.9608 | [M+H-2H2O]+PPM:19.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
758.9727 | [M+H-H2O]+PPM:17.5 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
776.0131 | [M-H2O+NH4]+PPM:0.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
777.0076 | [M+H]+PPM:14.2 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
794.035 | [M+NH4]+PPM:15 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
798.9681 | [M+Na]+PPM:13 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|