Cyclic diadenylate
Formula: C20H24N10O12P2 (658.105)
Chinese Name: 环二腺苷酸
BioDeep ID: BioDeep_00002053051
( View LC/MS Profile)
SMILES: O=P1(O)OCC2OC(N3C=NC=4C(=NC=NC43)N)C(O)C2OP(=O)(O)OCC5OC(N6C=NC=7C(=NC=NC76)N)C(O)C5O1
Found 10 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
681.0903 | [M+Na]+PPM:5.8 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
681.0874 | [M+Na]+PPM:10.1 |
Bathymodiolus | epithelial host cells | MALDI (DHB) |
MPIMM_039_QE_P_BP_CF_Bputeoserpentis_MALDI-FISH8_Sl14_s1_DHB_233x233_3um - MTBLS744Resolution: 3μm, 233x234
|
|
623.0802 | [M+H-2H2O]+PPM:17.6 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
681.088 | [M+Na]+PPM:9.2 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
623.0791 | [M+H-2H2O]+PPM:19.4 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
681.0874 | [M+Na]+PPM:10.1 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
623.0795 | [M+H-2H2O]+PPM:18.8 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
641.1054 | [M+H-H2O]+PPM:5.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
659.1173 | [M+H]+PPM:7.6 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
681.0873 | [M+Na]+PPM:10.2 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
Cyclic-di-AMP. CAS Common Chemistry. CAS, a division of the American Chemical Society, n.d. http://commonchemistry.cas.org/detail?cas_rn=54447-84-6 (retrieved 2024-07-02) (CAS RN: 54447-84-6). Licensed under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).