ST 27:1;O3
Formula: C27H46O3 (418.3447)
Chinese Name:
BioDeep ID: BioDeep_00000636711
( View LC/MS Profile)
SMILES: [C@@]12([C@]([C@H](O)C=C3[C@@]1(CC[C@@H](C3)O)C)([H])[C@]1([H])CC[C@]([H])([C@@H](CC[C@H](O)C(C)C)C)[C@@]1(C)CC2)[H]
Found 9 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
419.3538 | [M+H]+PPM:4.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
418.3409 | [M]+PPM:7.7 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
419.3544 | [M+H]+PPM:5.8 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
419.3521 | [M+H]+PPM:0.4 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
418.3408 | [M]+PPM:8 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
419.354 | [M+H]+PPM:4.9 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
|
|
419.3537 | [M+H]+PPM:4.2 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
419.3537 | [M+H]+PPM:4.2 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
419.3542 | [M+H]+PPM:5.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
|
|
7α, 25-dihydroxycholesterol (7α,25-OHC) is a potent and selective agonist and endogenous ligand of the orphan GPCR receptor EBI2 (GPR183). 7α, 25-dihydroxycholesterol is highly potent at activating EBI2 (EC50=140 pM; Kd=450 pM). 7α, 25-dihydroxycholesterol can serve as a chemokine directing migration of B cells, T cells and dendritic cells[1][2].