Asp-Asp-Asp-Asp-Lys
Formula: C22H34N6O14 (606.2133)
Chinese Name:
BioDeep ID: BioDeep_00000176256
( View LC/MS Profile)
SMILES: C(CCN)CC(C(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CC(=O)O)NC(=O)C(CC(=O)O)N
Found 9 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 606.2359 | [M-H2O+NH4]+PPM:1.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 645.3123 | [M+K]+PPM:1.9 |
Mus musculus | Lung | MALDI (DHB) |
image1 - MTBLS2075Resolution: 40μm, 187x165
Fig. 2 MALDI-MSI data from the same mouse lung tissue analyzed in Fig. 1. A: Optical image of the post-MSI, H&E-stained tissue section. B–D, F–G: Ion images of (B) m/z 796.6855 ([U13C-DPPC+Na]+), (C) m/z 756.5514 ([PC32:0+Na]+), (D) m/z 765.6079 ([D9-PC32:0+Na]+), (F) m/z 754.5359 ([PC32:1+Na]+), and (G) m/z 763.5923 ([D9-PC32:1+Na]+). E, H: Ratio images of (E) [D9-PC32:0+Na]+:[PC32:0+Na]+ and (H) [D9-PC32:1+Na]+:[PC32:1+Na]+. Part-per-million (ppm) mass errors are indicated in parentheses. All images were visualized using total-ion-current normalization and using hotspot removal (high quantile = 99%). DPPC = PC16:0/16:0. U13C-DPPC, universally 13C-labeled dipalmitoyl PC; PC, phosphatidylcholine; MSI, mass spectrometry imaging; H&E, hematoxylin and eosin.
Fig 1-3, Fig S1-S3, S5 |
|
| 607.2309 | [M+H]+PPM:17 |
Macropus giganteus | Brain | MALDI (BPYN) |
170321_kangaroobrain-dan3-pos_maxof50.0_med1 - 170321_kangaroobrain-dan3-pos_maxof50.0_med1Resolution: 50μm, 81x50
Sample information
Organism: Macropus giganteus (kangaroo)
Organism part: Brain
Condition: Wildtype
Sample growth conditions: Wild |
|
| 606.2359 | [M-H2O+NH4]+PPM:1.1 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
| 606.2364 | [M-H2O+NH4]+PPM:0.2 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
| 606.2364 | [M-H2O+NH4]+PPM:0.2 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
| 606.2354 | [M-H2O+NH4]+PPM:1.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
| 606.2354 | [M-H2O+NH4]+PPM:1.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
| 606.2354 | [M-H2O+NH4]+PPM:1.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
