9-Ethyl-4,6,9,10,11-pentahydroxy-7-[(2R,4S,5S,6S)-5-hydroxy-6-methyl-4-morpholin-4-yloxan-2-yl]oxy-8,10-dihydro-7H-tetracene-5,12-dione
Formula: C30H35NO11 (585.221)
Chinese Name:
BioDeep ID: BioDeep_00000172564
( View LC/MS Profile)
SMILES: CCC1(O)CC(OC2CC(C(O)C(C)O2)N2CCOCC2)C2=C(O)C3=C(C(O)=C2C1O)C(=O)C1=C(C(O)=CC=C1)C3=O
Found 11 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 586.2296 | [M+H]+PPM:2.3 |
Mus musculus | Lung | MALDI (DHB) |
image3 - MTBLS2075Resolution: 40μm, 146x190
Fig. 4 MALDI-MSI data of mouse lung tissue after administration with D9-choline and U13C-DPPC–containing Poractant alfa surfactant (labels administered 12 h prior to tissue collection). Ion images of (A) m/z 796.6856 ([U13C-DPPC+Na]+), (B) m/z 756.5154 [PC32:0+Na]+), and (C) m/z 765.6079 ([D9-PC32:0+Na]+). D: Overlay image of [U13C-PC32:0+Na]+ (red) and [D9-PC32:0+Na]+ (green). Part-per-million (ppm) mass errors are indicated in parentheses. All images were visualized using total-ion-current normalization and using hotspot removal (high quantile = 99%). DPPC = PC16:0/16:0. MSI, mass spectrometry imaging; PC, phosphatidylcholine; U13C-DPPC, universally 13C-labeled dipalmitoyl PC. |
|
| 586.2328 | [M+H]+PPM:7.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
| 586.2309 | [M+H]+PPM:4.5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
| 586.2317 | [M+H]+PPM:5.8 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
| 586.2317 | [M+H]+PPM:5.8 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
| 586.2303 | [M+H]+PPM:3.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
| 586.2302 | [M+H]+PPM:3.3 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
| 586.2302 | [M+H]+PPM:3.3 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
| 586.2318 | [M+H]+PPM:6 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
| 586.2313 | [M+H]+PPM:5.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
| 586.2322 | [M+H]+PPM:6.7 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
