Cholic acid glucuronide
                        Formula: C30H48O11 (584.3196)
                        
                        Chinese Name:  
                        BioDeep ID: BioDeep_00000027833 
                        ( View LC/MS Profile)
                        SMILES:  [H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@@H](CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)O[C@]1([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O)[C@H](C)CCC(O)=O
                    
Found 18 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 607.2991 | [M+Na]+PPM:16.1 | 
                                    Rattus norvegicus | Epididymis | MALDI (DHB) | 
                                        epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
                                              | 
                                    
                                        
                                             | 
                                
| 607.2991 | [M+Na]+PPM:16.1 | 
                                    Rattus norvegicus | Epididymis | MALDI (DHB) | 
                                        epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
                                              | 
                                    
                                        
                                             | 
                                
| 607.2991 | [M+Na]+PPM:16.1 | 
                                    Rattus norvegicus | Epididymis | MALDI (DHB) | 
                                        epik_dhb_head_ito01_06 - MTBLS58Resolution: 17μm, 183x103
                                              | 
                                    
                                        
                                             | 
                                
| 585.3188 | [M+H]+PPM:13.9 | 
                                    Mus musculus | Lung | MALDI (DHB) | 
                                        image1 - MTBLS2075Resolution: 40μm, 187x165
                                             Fig. 2 MALDI-MSI data from the same mouse lung tissue analyzed in Fig. 1. A: Optical image of the post-MSI, H&E-stained tissue section. B–D, F–G: Ion images of (B) m/z 796.6855 ([U13C-DPPC+Na]+), (C) m/z 756.5514 ([PC32:0+Na]+), (D) m/z 765.6079 ([D9-PC32:0+Na]+), (F) m/z 754.5359 ([PC32:1+Na]+), and (G) m/z 763.5923 ([D9-PC32:1+Na]+). E, H: Ratio images of (E) [D9-PC32:0+Na]+:[PC32:0+Na]+ and (H) [D9-PC32:1+Na]+:[PC32:1+Na]+. Part-per-million (ppm) mass errors are indicated in parentheses. All images were visualized using total-ion-current normalization and using hotspot removal (high quantile = 99%). DPPC = PC16:0/16:0. U13C-DPPC, universally 13C-labeled dipalmitoyl PC; PC, phosphatidylcholine; MSI, mass spectrometry imaging; H&E, hematoxylin and eosin.
Fig 1-3, Fig S1-S3, S5  | 
                                    
                                        
                                             | 
                                
| 585.329 | [M+H]+PPM:3.5 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
                                              | 
                                    
                                        
                                             | 
                                
| 567.3269 | [M+H-H2O]+PPM:18.6 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_4 - MTBLS385Resolution: 17μm, 82x80
                                              | 
                                    
                                        
                                             | 
                                
| 585.3284 | [M+H]+PPM:2.5 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
                                              | 
                                    
                                        
                                             | 
                                
| 585.3297 | [M+H]+PPM:4.7 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
                                              | 
                                    
                                        
                                             | 
                                
| 585.3281 | [M+H]+PPM:2 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
                                              | 
                                    
                                        
                                             | 
                                
| 585.3292 | [M+H]+PPM:3.9 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO26_7_1 - MTBLS385Resolution: 17μm, 75x74
                                              | 
                                    
                                        
                                             | 
                                
| 585.3296 | [M+H]+PPM:4.6 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
                                              | 
                                    
                                        
                                             | 
                                
| 585.329 | [M+H]+PPM:3.5 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO26_7_3 - MTBLS385Resolution: 75μm, 82x88
                                              | 
                                    
                                        
                                             | 
                                
| 585.3293 | [M+H]+PPM:4.1 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_5 - MTBLS385Resolution: 75μm, 135x94
                                              | 
                                    
                                        
                                             | 
                                
| 585.3291 | [M+H]+PPM:3.7 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
                                              | 
                                    
                                        
                                             | 
                                
| 585.3289 | [M+H]+PPM:3.4 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
                                              | 
                                    
                                        
                                             | 
                                
| 585.3308 | [M+H]+PPM:6.6 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
                                              | 
                                    
                                        
                                             | 
                                
| 585.3291 | [M+H]+PPM:3.7 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
                                              | 
                                    
                                        
                                             | 
                                
| 585.328 | [M+H]+PPM:1.8 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
                                              | 
                                    
                                        
                                             | 
                                
Cholic acid glucuronide is the glucuronidated metabolite of cholic acid, one of the four main acids produced by the liver where it is synthesized from cholesterol. Upon formation, the glucuronide is rapidly and effectively cleared from the circulation and excreted via urine. (PMID:4020296) [HMDB] Cholic acid glucuronide is the glucuronidated metabolite of cholic acid, one of the four main acids produced by the liver where it is synthesized from cholesterol. Upon formation, the glucuronide is rapidly and effectively cleared from the circulation and excreted via urine. (PMID:4020296). D005765 - Gastrointestinal Agents > D001647 - Bile Acids and Salts D005765 - Gastrointestinal Agents > D002793 - Cholic Acids
