Glabrin C
Formula: C41H64N8O9 (812.4796)
Chinese Name:
BioDeep ID: BioDeep_00000024635
( View LC/MS Profile)
SMILES: CC(C)CC1NC(=O)C(NC(=O)C(CC2=CC=C(O)C=C2)NC(=O)CNC(=O)C2CCCN2C(=O)C(NC(=O)C(CC(C)C)NC(=O)C(C)NC1=O)C(C)C)C(C)C
Found 15 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 813.4834 | [M+H]+PPM:4.3 |
Rattus norvegicus | Brain | MALDI (CHCA) |
Spectroswiss - sol_2x_br_2 - 2016-09-29_07h40m45sResolution: 17μm, 488x193
|
|
| 813.4838 | [M+H]+PPM:3.8 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 813.4834 | [M+H]+PPM:4.3 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
| 813.4836 | [M+H]+PPM:4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
| 813.4832 | [M+H]+PPM:4.5 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_46 - MTBLS58Resolution: 17μm, 298x106
|
|
| 813.4831 | [M+H]+PPM:4.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_47 - MTBLS58Resolution: 17μm, 301x111
|
|
| 813.4832 | [M+H]+PPM:4.5 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 813.4835 | [M+H]+PPM:4.2 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
| 813.4835 | [M+H]+PPM:4.2 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
| 813.4913 | [M+H]+PPM:5.4 |
Macropus giganteus | Brain | MALDI (BPYN) |
170321_kangaroobrain-dan3-pos_maxof50.0_med1 - 170321_kangaroobrain-dan3-pos_maxof50.0_med1Resolution: 50μm, 81x50
Sample information
Organism: Macropus giganteus (kangaroo)
Organism part: Brain
Condition: Wildtype
Sample growth conditions: Wild |
|
| 813.4828 | [M+H]+PPM:5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
| 813.4837 | [M+H]+PPM:3.9 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
| 813.4835 | [M+H]+PPM:4.2 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
| 813.4833 | [M+H]+PPM:4.4 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
| 813.4832 | [M+H]+PPM:4.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
Glabrin C is found in alcoholic beverages. Glabrin C is a constituent of the seeds of Annona glabra (pond apple). Constituent of the seeds of Annona glabra (pond apple). Glabrin C is found in alcoholic beverages and fruits.
