Lyciumoside IV
Formula: C38H64O16 (776.4194)
Chinese Name:
BioDeep ID: BioDeep_00000019093
( View LC/MS Profile)
SMILES: CC1OC(OC2C(CO)OC(OC(C)(CC\C=C(/C)CC\C=C(\C)CC\C=C(/C)COC3OC(CO)C(O)C(O)C3O)C=C)C(O)C2O)C(O)C(O)C1O
Found 19 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
777.4233 | [M+H]+PPM:4.4 |
Rattus norvegicus | Brain | MALDI (CHCA) |
Spectroswiss - sol_2x_br_2 - 2016-09-29_07h40m45sResolution: 17μm, 488x193
|
|
777.424 | [M+H]+PPM:3.5 |
Mus musculus | Left upper arm | MALDI (CHCA) |
357_l_total ion count - Limb defect imaging - Monash UniversityResolution: 50μm, 97x131
Diseased |
|
777.422 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
777.4208 | [M+H]+PPM:7.6 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
777.4232 | [M+H]+PPM:4.5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
794.4505 | [M+NH4]+PPM:3.4 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
799.4086 | [M+Na]+PPM: |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
777.4234 | [M+H]+PPM:4.2 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
777.4232 | [M+H]+PPM:4.5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
794.4528 | [M+NH4]+PPM:0.6 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
777.4231 | [M+H]+PPM:4.6 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
794.4505 | [M+NH4]+PPM:3.4 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
799.4086 | [M+Na]+PPM: |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
777.4232 | [M+H]+PPM:4.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
794.4501 | [M+NH4]+PPM:4 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
799.4083 | [M+Na]+PPM:0.4 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
777.4231 | [M+H]+PPM:4.6 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
794.4502 | [M+NH4]+PPM:3.8 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
799.4084 | [M+Na]+PPM:0.3 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
Constituent of Lycium chinense (Chinese boxthorn). Lyciumoside IV is found in tea, coffee and coffee products, and herbs and spices. Lyciumoside IV is found in coffee and coffee products. Lyciumoside IV is a constituent of Lycium chinense (Chinese boxthorn).