Diosmetin 7-O-beta-D-glucuronopyranoside
                        Formula: C22H20O12 (476.0955)
                        
                        Chinese Name:  
                        BioDeep ID: BioDeep_00000017603 
                        ( View LC/MS Profile)
                        SMILES:  c1(cc(c2c(c1)oc(cc2=O)c1ccc(c(c1)O)OC)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@@H](O1)C(=O)O)O)O)O
                    
Found 9 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 476.0884 | [M]+PPM:13.7 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
                                             Grape berries fruit, condition: Ripe  | 
                                    
                                        
                                             | 
                                
| 477.1004 | [M+H]+PPM:4.9 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
                                             Grape berries fruit, condition: Ripe  | 
                                    
                                        
                                             | 
                                
| 477.1004 | [M+H]+PPM:4.9 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 476.0883 | [M]+PPM:13.9 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 477.1005 | [M+H]+PPM:4.7 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 515.1967 | [M+K]+PPM:6.7 | 
                                    Rattus norvegicus | Epididymis | MALDI (DHB) | 
                                        epik_dhb_head_ito08_47 - MTBLS58Resolution: 17μm, 301x111
                                              | 
                                    
                                        
                                             | 
                                
| 477.101 | [M+H]+PPM:3.7 | 
                                    Posidonia oceanica | root | MALDI (CHCA) | 
                                        20190613_MS1_A19r-18 - MTBLS1746Resolution: 17μm, 246x264
                                              | 
                                    
                                        
                                             | 
                                
| 477.0949 | [M+H]+PPM:16.5 | 
                                    Mytilus edulis | mantle | MALDI (DHB) | 
                                        20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
                                              | 
                                    
                                        
                                             | 
                                
| 477.0946 | [M+H]+PPM:17.1 | 
                                    Mytilus edulis | mantle | MALDI (DHB) | 
                                        20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
                                              | 
                                    
                                        
                                             | 
                                
Diosmetin 7-O-beta-D-glucuronopyranoside is found in fats and oils. Diosmetin 7-O-beta-D-glucuronopyranoside is isolated from Majorana hortensis (sweet majoram). Isolated from Majorana hortensis (sweet majoram). Diosmetin 7-glucuronide is found in spearmint, sweet marjoram, and fats and oils. Diosmetin 7-O-beta-D-glucuronopyranoside is a member of flavonoids and a glucosiduronic acid. DiosMetin 7-O-β-D-Glucuronide is an antioxidant constituent in the fruits of Luffa cylindrical[1].
