(±)-Mephosfolan
Formula: C8H16NO3PS2 (269.0309)
Chinese Name: 地安磷
BioDeep ID: BioDeep_00000012551
( View LC/MS Profile)
SMILES: CCOP(=O)(OCC)\N=C1\SCC(C)S1
Found 8 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
270.0389 | [M+H]+PPM:2.6 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
270.0392 | [M+H]+PPM:3.7 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
270.0389 | [M+H]+PPM:2.6 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
270.039 | [M+H]+PPM:3 |
Homo sapiens | esophagus | DESI () |
LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
|
|
234.0137 | [M+H-2H2O]+PPM:14.4 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
234.0132 | [M+H-2H2O]+PPM:16.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
234.0132 | [M+H-2H2O]+PPM:16.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
234.0132 | [M+H-2H2O]+PPM:16.5 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
(±)-Mephosfolan is an Agricultural insecticide with contact and stomach action, now supersede