Dihomo-gamma-linolenic acid
Formula: C20H34O2 (306.2559)
Chinese Name: 顺式-8,11,14-二十碳三烯酸, 二十烷三烯酸, 8,11-14-廿碳三烯酸
BioDeep ID: BioDeep_00000001308
( View LC/MS Profile)
SMILES: CCCCCC=CCC=CCC=CCCCCCCC(O)=O
Found 88 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 306.2548 | [M]+PPM:1.7 |
Marker Pen | NA | DESI (None) |
3ul_0.8Mpa_RAW_20241016-PAPER PNMK - MEMI_testResolution: 30μm, 315x42
By writing the four English letters “PNMK” on white paper with a marker pen, and then scanning with a DESI ion source to obtain the scanning result. The signal of the chemical substances on the marker pen used appears on the channel with an m/z value of |
|
| 307.2608 | [M+H]+PPM:7.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 271.2381 | [M+H-2H2O]+PPM:14.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_17 - MTBLS58Resolution: 17μm, 208x108
1 male adult wild-type rat was obtained from Inserm U1085 - Irset Research Institute (University of Rennes1, France). Animals were age 60 days and were reared under ad-lib conditions. Care and handling of all animals complied with EU directive 2010/63/EU on the protection of animals used for scientific purposes. The whole epididymis was excised from each animal immediately post-mortem, loosely wrapped rapidly in an aluminum foil and a 2.5% (w/v) carboxymethylcellulose (CMC) solution was poured to embed the epididymis to preserve their morphology. To remove air bubbles, the filled aluminum molds was gently freezed by depositing it on isopentane or dry ice, then on the nitrogen vapors and finally by progressively dipping the CMC/sample coated with aluminum foil into liquid nitrogen (or only flush with liquid nitrogen). Frozen tissues were stored at -80 °C until use to avoid degradation. |
|
| 271.238 | [M+H-2H2O]+PPM:14.8 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 271.238 | [M+H-2H2O]+PPM:14.8 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
| 271.2382 | [M+H-2H2O]+PPM:14.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
| 271.2382 | [M+H-2H2O]+PPM:14.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_46 - MTBLS58Resolution: 17μm, 298x106
|
|
| 307.2608 | [M+H]+PPM:7.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
| 307.2608 | [M+H]+PPM:7.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
| 271.2382 | [M+H-2H2O]+PPM:14.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_47 - MTBLS58Resolution: 17μm, 301x111
|
|
| 271.2385 | [M+H-2H2O]+PPM:13 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 271.2384 | [M+H-2H2O]+PPM:13.3 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 271.2383 | [M+H-2H2O]+PPM:13.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
| 271.2383 | [M+H-2H2O]+PPM:13.7 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
| 271.2382 | [M+H-2H2O]+PPM:14.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_06 - MTBLS58Resolution: 17μm, 183x103
|
|
| 271.2384 | [M+H-2H2O]+PPM:13.3 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 306.2525 | [M]+PPM:9.2 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
| 307.2647 | [M+H]+PPM:5.1 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
| 306.2512 | [M]+PPM:13.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_4 - MTBLS385Resolution: 17μm, 82x80
|
|
| 307.2635 | [M+H]+PPM:1.2 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_4 - MTBLS385Resolution: 17μm, 82x80
|
|
| 306.2521 | [M]+PPM:10.5 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
| 307.2645 | [M+H]+PPM:4.4 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
| 306.2518 | [M]+PPM:11.5 |
Homo sapiens | esophagus | DESI () |
TO42T - MTBLS385Resolution: 17μm, 69x81
|
|
| 307.2641 | [M+H]+PPM:3.1 |
Homo sapiens | esophagus | DESI () |
TO42T - MTBLS385Resolution: 17μm, 69x81
|
|
| 306.2529 | [M]+PPM:7.9 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
| 307.2652 | [M+H]+PPM:6.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
| 306.252 | [M]+PPM:10.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_1 - MTBLS385Resolution: 17μm, 69x54
|
|
| 307.2643 | [M+H]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_1 - MTBLS385Resolution: 17μm, 69x54
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | esophagus | DESI () |
TO39T - MTBLS385Resolution: 17μm, 69x81
|
|
| 307.264 | [M+H]+PPM:2.8 |
Homo sapiens | esophagus | DESI () |
TO39T - MTBLS385Resolution: 17μm, 69x81
|
|
| 306.2508 | [M]+PPM:14.8 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
80TopL, 50TopR, 70BottomL, 60BottomR-profile - MTBLS415Resolution: 17μm, 137x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 307.2678 | [M+H]+PPM:15.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
80TopL, 50TopR, 70BottomL, 60BottomR-profile - MTBLS415Resolution: 17μm, 137x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 306.2507 | [M]+PPM:15.1 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
520TopL, 490TopR, 510BottomL, 500BottomR-profile - MTBLS415Resolution: 17μm, 147x131
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 307.2674 | [M+H]+PPM:13.9 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
520TopL, 490TopR, 510BottomL, 500BottomR-profile - MTBLS415Resolution: 17μm, 147x131
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 306.2549 | [M]+PPM:1.4 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
439TopL, 409TopR, 429BottomL, 419BottomR-profile - MTBLS415Resolution: 17μm, 157x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 307.2646 | [M+H]+PPM:4.7 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
439TopL, 409TopR, 429BottomL, 419BottomR-profile - MTBLS415Resolution: 17μm, 157x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 306.251 | [M]+PPM:14.1 |
Homo sapiens | NA | DESI () |
160TopL,130TopR,150BottomL,140BottomR-profile - MTBLS415Resolution: 17μm, 142x136
|
|
| 307.2627 | [M+H]+PPM:1.4 |
Homo sapiens | NA | DESI () |
160TopL,130TopR,150BottomL,140BottomR-profile - MTBLS415Resolution: 17μm, 142x136
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
| 307.2642 | [M+H]+PPM:3.4 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
| 306.2525 | [M]+PPM:9.2 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_1 - MTBLS385Resolution: 17μm, 75x74
|
|
| 307.2648 | [M+H]+PPM:5.4 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_1 - MTBLS385Resolution: 17μm, 75x74
|
|
| 306.2529 | [M]+PPM:7.9 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
| 307.2652 | [M+H]+PPM:6.7 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
| 306.2524 | [M]+PPM:9.5 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_3 - MTBLS385Resolution: 75μm, 82x88
|
|
| 307.2647 | [M+H]+PPM:5.1 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_3 - MTBLS385Resolution: 75μm, 82x88
|
|
| 306.252 | [M]+PPM:10.8 |
Homo sapiens | esophagus | DESI () |
TO31T - MTBLS385Resolution: 75μm, 56x54
|
|
| 307.2643 | [M+H]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
TO31T - MTBLS385Resolution: 75μm, 56x54
|
|
| 306.2525 | [M]+PPM:9.2 |
Homo sapiens | esophagus | DESI () |
TO29T - MTBLS385Resolution: 75μm, 56x48
|
|
| 307.2648 | [M+H]+PPM:5.4 |
Homo sapiens | esophagus | DESI () |
TO29T - MTBLS385Resolution: 75μm, 56x48
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | esophagus | DESI () |
TO41T - MTBLS385Resolution: 75μm, 69x43
|
|
| 307.2642 | [M+H]+PPM:3.4 |
Homo sapiens | esophagus | DESI () |
TO41T - MTBLS385Resolution: 75μm, 69x43
|
|
| 306.252 | [M]+PPM:10.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_2 - MTBLS385Resolution: 75μm, 108x68
|
|
| 307.2644 | [M+H]+PPM:4.1 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_2 - MTBLS385Resolution: 75μm, 108x68
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_3 - MTBLS385Resolution: 75μm, 69x54
|
|
| 307.2643 | [M+H]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_3 - MTBLS385Resolution: 75μm, 69x54
|
|
| 307.2645 | [M+H]+PPM:4.4 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_4 - MTBLS385Resolution: 75μm, 62x48
|
|
| 306.2521 | [M]+PPM:10.5 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
| 307.2644 | [M+H]+PPM:4.1 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
| 306.2521 | [M]+PPM:10.5 |
Homo sapiens | esophagus | DESI () |
LNTO30_17_2 - MTBLS385Resolution: 75μm, 82x54
|
|
| 307.2644 | [M+H]+PPM:4.1 |
Homo sapiens | esophagus | DESI () |
LNTO30_17_2 - MTBLS385Resolution: 75μm, 82x54
|
|
| 306.2527 | [M]+PPM:8.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_5 - MTBLS385Resolution: 75μm, 135x94
|
|
| 307.265 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_5 - MTBLS385Resolution: 75μm, 135x94
|
|
| 306.2526 | [M]+PPM:8.9 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
|
|
| 307.2648 | [M+H]+PPM:5.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
|
|
| 306.2524 | [M]+PPM:9.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
| 307.2647 | [M+H]+PPM:5.1 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
| 306.2524 | [M]+PPM:9.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
| 307.2647 | [M+H]+PPM:5.1 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
| 306.2527 | [M]+PPM:8.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
|
|
| 307.265 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
|
|
| 306.2525 | [M]+PPM:9.2 |
Homo sapiens | esophagus | DESI () |
LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
|
|
| 307.2648 | [M+H]+PPM:5.4 |
Homo sapiens | esophagus | DESI () |
LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | esophagus | DESI () |
LNTO29_18_2 - MTBLS385Resolution: 75μm, 62x68
|
|
| 307.2642 | [M+H]+PPM:3.4 |
Homo sapiens | esophagus | DESI () |
LNTO29_18_2 - MTBLS385Resolution: 75μm, 62x68
|
|
| 306.2521 | [M]+PPM:10.5 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_1 - MTBLS385Resolution: 75μm, 69x68
|
|
| 307.2644 | [M+H]+PPM:4.1 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_1 - MTBLS385Resolution: 75μm, 69x68
|
|
| 306.252 | [M]+PPM:10.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
|
|
| 307.2643 | [M+H]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
|
|
| 306.2518 | [M]+PPM:11.5 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
| 307.2641 | [M+H]+PPM:3.1 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
| 306.2521 | [M]+PPM:10.5 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
200TopL, 170TopR, 190BottomL, 180BottomR-centroid - MTBLS176Resolution: 50μm, 132x126
|
|
| 307.2644 | [M+H]+PPM:4.1 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
200TopL, 170TopR, 190BottomL, 180BottomR-centroid - MTBLS176Resolution: 50μm, 132x126
|
|
| 306.2518 | [M]+PPM:11.5 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
| 307.264 | [M+H]+PPM:2.8 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
| 306.2519 | [M]+PPM:11.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
| 307.2643 | [M+H]+PPM:3.8 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
| 306.2791 | [M-H2O+NH4]+PPM:0.1 |
Drosophila melanogaster | brain | MALDI (DHB) |
Drosophila18 - 2019-10-16_14h26m34sResolution: 5μm, 686x685
Sample information
Organism: Drosophila melanogaster
Organism part: Brain
Condition: Healthy
Sample preparation
Sample stabilisation: Frozen
Tissue modification: Frozen
MALDI matrix: 2,5-dihydroxybenzoic acid (DHB)
MALDI matrix application: TM sprayer
Solvent: Aceton/water
MS analysis
Polarity: Positive
Ionisation source: Prototype
Analyzer: Orbitrap
Pixel size: 5μm × 5μm
Annotation settings
m/z tolerance (ppm): 3
Analysis version: Original MSM
Pixel count: 469910
Imzml file size: 696.23 MB
Ibd file size: 814.11 MB |
|
8,11,14-Eicosatrienoic acid is a 20-carbon-chain omega-6 fatty acid, unsaturated at positions 8, 11, and 14. It differs from arachidonic acid (5,8,11,14-eicosatetraenoic acid) only at position 5. 8,11,14-Eicosatrienoic acid is also known as Dihomo-gamma-linolenic acid (DGLA). In physiological literature, it is given the name 20:3(n-6). DGLA is the elongation product of the 18 carbon gamma-linolenic acid (GLA). DGLA can be converted into prostaglandin E1 (PGE1). PGE1 inhibits platelet aggregation and also exerts a vasodilatory effect. DGLA competes with arachadonic acid for COX and lipoxygenase, inhibiting the production of arachadonic acids eicosanoids [HMDB] 8,11,14-Eicosatrienoic acid is a 20-carbon-chain omega-6 fatty acid, unsaturated at positions 8, 11, and 14. It differs from arachidonic acid (5,8,11,14-eicosatetraenoic acid) only at position 5. 8,11,14-Eicosatrienoic acid is also known as Dihomo-gamma-linolenic acid (DGLA). In physiological literature, it is given the name 20:3(n-6). DGLA is the elongation product of the 18 carbon gamma-linolenic acid (GLA). DGLA can be converted into prostaglandin E1 (PGE1). PGE1 inhibits platelet aggregation and also exerts a vasodilatory effect. DGLA competes with arachadonic acid for COX and lipoxygenase, inhibiting the production of arachadonic acids eicosanoids. Dihomo-γ-linolenic acid. CAS Common Chemistry. CAS, a division of the American Chemical Society, n.d. https://commonchemistry.cas.org/detail?cas_rn=1783-84-2 (retrieved 2024-07-01) (CAS RN: 1783-84-2). Licensed under the Attribution-Noncommercial 4.0 International License (CC BY-NC 4.0).
