solasodine 3-O-beta-D-glucopyranoside
Formula: C33H52NO7 (574.3744)
Chinese Name:
BioDeep ID: BioDeep_00000229161
( View LC/MS Profile)
SMILES: CC1C2C(CC3C4CC=C5CC(CCC5(C)C4CCC23C)OC2OC(CO)C(O)C(O)C2O)OC11CCC(C)C[N+]1
Found 10 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
539.3592 | [M+H-2H2O]+PPM:2.4 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
557.3698 | [M+H-H2O]+PPM:2.3 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
539.359 | [M+H-2H2O]+PPM:2.8 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
557.3696 | [M+H-H2O]+PPM:2.6 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
539.3592 | [M+H-2H2O]+PPM:2.4 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
557.37 | [M+H-H2O]+PPM:1.9 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
539.3596 | [M+H-2H2O]+PPM:1.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
557.37 | [M+H-H2O]+PPM:1.9 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
539.359 | [M+H-2H2O]+PPM:2.8 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
|
|
557.3692 | [M+H-H2O]+PPM:3.4 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
|
|
Solasodine 3-o-beta-d-glucopyranoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Solasodine 3-o-beta-d-glucopyranoside can be found in a number of food items such as black crowberry, canada blueberry, fig, and cherry tomato, which makes solasodine 3-o-beta-d-glucopyranoside a potential biomarker for the consumption of these food products.