Ret-P-man
Formula: C26H41O9P (528.2488)
Chinese Name:
BioDeep ID: BioDeep_00000182903
( View LC/MS Profile)
SMILES: CC(=CCOP(O)(=O)OC1OC(CO)C(O)C(O)C1O)C=CC=C(C)C=CC1=C(C)CCCC1(C)C
Found 32 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 528.2733 | [M-H2O+NH4]+PPM:2.3 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
| 528.2724 | [M-H2O+NH4]+PPM:0.6 |
Homo sapiens | esophagus | DESI () |
TO42T - MTBLS385Resolution: 17μm, 69x81
|
|
| 528.2747 | [M-H2O+NH4]+PPM:5 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
| 528.2731 | [M-H2O+NH4]+PPM:2 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_1 - MTBLS385Resolution: 17μm, 69x54
|
|
| 528.2729 | [M-H2O+NH4]+PPM:1.6 |
Homo sapiens | esophagus | DESI () |
TO39T - MTBLS385Resolution: 17μm, 69x81
|
|
| 529.2653 | [M+H]+PPM:17.4 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
80TopL, 50TopR, 70BottomL, 60BottomR-profile - MTBLS415Resolution: 17μm, 137x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 528.2584 | [M]+PPM:19.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
520TopL, 490TopR, 510BottomL, 500BottomR-profile - MTBLS415Resolution: 17μm, 147x131
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 529.2656 | [M+H]+PPM:18 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
520TopL, 490TopR, 510BottomL, 500BottomR-profile - MTBLS415Resolution: 17μm, 147x131
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 529.2655 | [M+H]+PPM:17.8 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
439TopL, 409TopR, 429BottomL, 419BottomR-profile - MTBLS415Resolution: 17μm, 157x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 528.2731 | [M-H2O+NH4]+PPM:2 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
| 528.2741 | [M-H2O+NH4]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_1 - MTBLS385Resolution: 17μm, 75x74
|
|
| 528.2747 | [M-H2O+NH4]+PPM:5 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
| 528.2739 | [M-H2O+NH4]+PPM:3.5 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_3 - MTBLS385Resolution: 75μm, 82x88
|
|
| 528.2719 | [M-H2O+NH4]+PPM:0.3 |
Homo sapiens | esophagus | DESI () |
TO40T - MTBLS385Resolution: 17μm, 82x74
|
|
| 528.273 | [M-H2O+NH4]+PPM:1.8 |
Homo sapiens | esophagus | DESI () |
TO31T - MTBLS385Resolution: 75μm, 56x54
|
|
| 528.274 | [M-H2O+NH4]+PPM:3.7 |
Homo sapiens | esophagus | DESI () |
TO29T - MTBLS385Resolution: 75μm, 56x48
|
|
| 528.2731 | [M-H2O+NH4]+PPM:2 |
Homo sapiens | esophagus | DESI () |
TO41T - MTBLS385Resolution: 75μm, 69x43
|
|
| 528.2733 | [M-H2O+NH4]+PPM:2.3 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_2 - MTBLS385Resolution: 75μm, 108x68
|
|
| 528.2733 | [M-H2O+NH4]+PPM:2.3 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_3 - MTBLS385Resolution: 75μm, 69x54
|
|
| 528.2735 | [M-H2O+NH4]+PPM:2.7 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_4 - MTBLS385Resolution: 75μm, 62x48
|
|
| 528.2735 | [M-H2O+NH4]+PPM:2.7 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
| 528.2744 | [M-H2O+NH4]+PPM:4.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_5 - MTBLS385Resolution: 75μm, 135x94
|
|
| 528.2742 | [M-H2O+NH4]+PPM:4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
|
|
| 528.2739 | [M-H2O+NH4]+PPM:3.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
| 528.2739 | [M-H2O+NH4]+PPM:3.5 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
| 528.2744 | [M-H2O+NH4]+PPM:4.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
|
|
| 528.274 | [M-H2O+NH4]+PPM:3.7 |
Homo sapiens | esophagus | DESI () |
LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
|
|
| 528.2731 | [M-H2O+NH4]+PPM:2 |
Homo sapiens | esophagus | DESI () |
LNTO29_18_2 - MTBLS385Resolution: 75μm, 62x68
|
|
| 528.2734 | [M-H2O+NH4]+PPM:2.5 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_1 - MTBLS385Resolution: 75μm, 69x68
|
|
| 528.2728 | [M-H2O+NH4]+PPM:1.4 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
| 528.2733 | [M-H2O+NH4]+PPM:2.3 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
200TopL, 170TopR, 190BottomL, 180BottomR-centroid - MTBLS176Resolution: 50μm, 132x126
|
|
| 528.2727 | [M-H2O+NH4]+PPM:1.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
