IB-Meca
Formula: C18H19IN6O4 (510.0512)
Chinese Name:
BioDeep ID: BioDeep_00000179895
( View LC/MS Profile)
SMILES: CNC(=O)C1C(C(C(O1)N2C=NC3=C(N=CN=C32)NCC4=CC(=CC=C4)I)O)O
Found 5 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 510.0553 | [M]+PPM:9 |
Homo sapiens | Liver | MALDI (DHB) |
20171107_FIT4_DHBpos_p70_s50 - Rappez et al (2021) SpaceM reveals metabolic states of single cellsResolution: 50μm, 70x70
|
|
| 511.0632 | [M+H]+PPM:9.1 |
Homo sapiens | Liver | MALDI (DHB) |
20171107_FIT4_DHBpos_p70_s50 - Rappez et al (2021) SpaceM reveals metabolic states of single cellsResolution: 50μm, 70x70
|
|
| 511.0641 | [M+H]+PPM:10.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
| 511.0636 | [M+H]+PPM:9.9 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
| 511.0636 | [M+H]+PPM:9.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
