2-Decarboxyphyllocactin
Formula: C26H29N2O14+ (593.1619)
Chinese Name:
BioDeep ID: BioDeep_00000035119
( View LC/MS Profile)
SMILES: C1C[N+](=CC=C2CC(NC(=C2)C(=O)O)C(=O)O)C3=CC(=C(C=C31)OC4C(C(C(C(O4)COC(=O)CC(=O)O)O)O)O)O
Found 7 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
616.1632 | [M+Na]+PPM:19.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
616.1573 | [M+Na]+PPM:10.1 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
616.1564 | [M+Na]+PPM:8.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
616.1592 | [M+Na]+PPM:13.2 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_46 - MTBLS58Resolution: 17μm, 298x106
|
|
616.1631 | [M+Na]+PPM:19.5 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
616.1595 | [M+Na]+PPM:13.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
616.1562 | [M+Na]+PPM:8.3 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
2-Decarboxyphyllocactin is found in root vegetables. 2-Decarboxyphyllocactin is a constituent of Beta vulgaris. Constituent of Beta vulgaris. 2-Decarboxyphyllocactin is found in root vegetables.