Monomenthyl succinate
Formula: C14H24O4 (256.1675)
Chinese Name:
BioDeep ID: BioDeep_00000035011
( View LC/MS Profile)
SMILES: CC1CCC(C(C1)OC(=O)CCC(=O)O)C(C)C
Found 12 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 257.1749 | [M+H]+PPM:0.7 |
Marker Pen | NA | DESI (None) |
3ul_0.8Mpa_RAW_20241016-PAPER PNMK - MEMI_testResolution: 30μm, 315x42
By writing the four English letters “PNMK” on white paper with a marker pen, and then scanning with a DESI ion source to obtain the scanning result. The signal of the chemical substances on the marker pen used appears on the channel with an m/z value of |
|
| 257.1736 | [M+H]+PPM:4.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 257.1736 | [M+H]+PPM:4.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_43 - MTBLS58Resolution: 17μm, 298x106
|
|
| 257.174 | [M+H]+PPM:2.8 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_44 - MTBLS58Resolution: 17μm, 299x111
|
|
| 257.1739 | [M+H]+PPM:3.2 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_46 - MTBLS58Resolution: 17μm, 298x106
|
|
| 257.1741 | [M+H]+PPM:2.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_47 - MTBLS58Resolution: 17μm, 301x111
|
|
| 257.1743 | [M+H]+PPM:1.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 257.1737 | [M+H]+PPM:4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 257.1736 | [M+H]+PPM:4.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_03 - MTBLS58Resolution: 17μm, 159x110
|
|
| 257.1737 | [M+H]+PPM:4 |
Rattus norvegicus | normal | MALDI (DHB) |
epik_dhb_head_ito01_05 - MTBLS58Resolution: 17μm, 183x105
|
|
| 257.1735 | [M+H]+PPM:4.8 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_06 - MTBLS58Resolution: 17μm, 183x103
|
|
| 257.1741 | [M+H]+PPM:2.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
Monomenthyl succinate is a flavouring ingredient with a cooling, minty tast Flavouring ingredient with a cooling, minty taste
