22-Acetylpriverogenin B
Formula: C32H52O5 (516.3815)
Chinese Name:
BioDeep ID: BioDeep_00000034691
( View LC/MS Profile)
SMILES: CC(=O)OC1CC(C)(C)CC2C11COC22CCC3C4(C)CCC(O)C(C)(C)C4CCC3(C)C2(C)CC1O
Found 2 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
516.3955 | [M-H2O+NH4]+PPM:17.8 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
555.483 | [M+K]+PPM:6.8 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
Saponin from Primula veris (cowslip). 22-Acetylpriverogenin B is found in tea and herbs and spices. 22-Acetylpriverogenin B is found in herbs and spices. Saponin from Primula veris (cowslip