N-Acetylvanilalanine
                        Formula: C12H15NO5 (253.095)
                        
                        Chinese Name:  
                        BioDeep ID: BioDeep_00000032180 
                        ( View LC/MS Profile)
                        SMILES:  CC(=O)NC(CC1=CC(=C(C=C1)O)OC)C(=O)O
                    
Found 3 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 254.0999 | [M+H]+PPM:9.4 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO22_1_4 - MTBLS385Resolution: 17μm, 82x80
                                              | 
                                    
                                        
                                             | 
                                
| 254.1 | [M+H]+PPM:9 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
                                              | 
                                    
                                        
                                             | 
                                
| 254.1003 | [M+H]+PPM:7.8 | 
                                    Homo sapiens | esophagus | DESI () | 
                                        LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
                                              | 
                                    
                                        
                                             | 
                                
N-acetylvanilalanine is a catecholamine metabolite. Its accumulation is indicative of aromatic L-amino acid decarboxylase deficiency (PMID: 16288991). [HMDB] N-acetylvanilalanine is a catecholamine metabolite. Its accumulation is indicative of aromatic L-amino acid decarboxylase deficiency (PMID: 16288991).
