Dihydroferulic acid 4-O-glucuronide
Formula: C16H20O10 (372.1056)
Chinese Name:
BioDeep ID: BioDeep_00000027435
( View LC/MS Profile)
SMILES: COC1=C(O[C@@H]2O[C@@H]([C@@H](O)[C@H](O)[C@H]2O)C(O)=O)C=CC(CCC(O)=O)=C1
Found 2 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 373.1078 | [M+H]+PPM:13.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
| 373.107 | [M+H]+PPM:15.9 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
Dihydroferulic acid 4-O-glucuronide is a polyphenol metabolite detected in biological fluids (PMID: 20428313).
