[6]-Gingerdiol 5-O-beta-D-glucopyranoside
Formula: C23H38O9 (458.2516)
Chinese Name:
BioDeep ID: BioDeep_00000022410
( View LC/MS Profile)
SMILES: CCCCCC(CC(CCC1=CC(=C(C=C1)O)OC)O)OC2C(C(C(C(O2)CO)O)O)O
Found 12 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
441.2525 | [M+H-H2O]+PPM:9.6 |
Homo sapiens | esophagus | DESI () |
TO42T - MTBLS385Resolution: 17μm, 69x81
|
|
441.2539 | [M+H-H2O]+PPM:12.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
441.2518 | [M+H-H2O]+PPM:8 |
Homo sapiens | esophagus | DESI () |
TO40T - MTBLS385Resolution: 17μm, 82x74
|
|
441.2528 | [M+H-H2O]+PPM:10.2 |
Homo sapiens | esophagus | DESI () |
TO31T - MTBLS385Resolution: 75μm, 56x54
|
|
441.253 | [M+H-H2O]+PPM:10.7 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_2 - MTBLS385Resolution: 75μm, 108x68
|
|
441.253 | [M+H-H2O]+PPM:10.7 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_3 - MTBLS385Resolution: 75μm, 69x54
|
|
441.253 | [M+H-H2O]+PPM:10.7 |
Homo sapiens | esophagus | DESI () |
LNTO30_17_2 - MTBLS385Resolution: 75μm, 82x54
|
|
441.2533 | [M+H-H2O]+PPM:11.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
441.2525 | [M+H-H2O]+PPM:9.6 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
441.2529 | [M+H-H2O]+PPM:10.5 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
200TopL, 170TopR, 190BottomL, 180BottomR-centroid - MTBLS176Resolution: 50μm, 132x126
|
|
441.2524 | [M+H-H2O]+PPM:9.3 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
441.2528 | [M+H-H2O]+PPM:10.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
[6]-Gingerdiol 5-O-beta-D-glucopyranoside is found in herbs and spices. [6]-Gingerdiol 5-O-beta-D-glucopyranoside is a constituent of ginger (Zingiber officinale) rhizomes