3,4-Hexahydroxydiphenoylarabinose
Formula: C19H16O13 (452.0591)
Chinese Name:
BioDeep ID: BioDeep_00000022390
( View LC/MS Profile)
SMILES: C1C2C(C(C(O1)O)O)OC(=O)C3=CC(=C(C(=C3C4=C(C(=C(C=C4C(=O)O2)O)O)O)O)O)O
Found 7 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 417.0464 | [M+H-2H2O]+PPM:2.8 |
Mus musculus | Kidney | MALDI (CHCA) |
FULL_MS_centriod_CHCA_20210819 - FULL_MS_centriod_CHCA_20210819Resolution: 17μm, 638x437
AP-MALDI instrument demo test, mass spectrum scan in centroid mode. |
|
| 417.0484 | [M+H-2H2O]+PPM:7.6 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma-3-88b_centroid - MTBLS313Resolution: 17μm, 265x320
|
|
| 417.0488 | [M+H-2H2O]+PPM:8.5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_02_centroid - MTBLS313Resolution: 17μm, 434x258
|
|
| 417.0488 | [M+H-2H2O]+PPM:8.5 |
Mus musculus | brain | MALDI (DHB) |
Brain01_Bregma1-42_01_centroid - MTBLS313Resolution: 17μm, 447x118
|
|
| 417.0477 | [M+H-2H2O]+PPM:5.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
| 417.0477 | [M+H-2H2O]+PPM:5.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
| 417.0477 | [M+H-2H2O]+PPM:5.9 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
3,4-Hexahydroxydiphenoylarabinose is found in fruits. 3,4-Hexahydroxydiphenoylarabinose is isolated from fruits of Psidium guajava (guava). Isolated from fruits of Psidium guajava (guava). 3,4-Hexahydroxydiphenoylarabinose is found in fruits.
