11-Oxohexadecanoic acid
Formula: C16H30O3 (270.2195)
Chinese Name:
BioDeep ID: BioDeep_00000021389
( View LC/MS Profile)
SMILES: CCCCCC(=O)CCCCCCCCCC(=O)O
Found 32 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 271.2271 | [M+H]+PPM:1.3 |
Marker Pen | NA | DESI (None) |
3ul_0.8Mpa_RAW_20241016-PAPER PNMK - MEMI_testResolution: 30μm, 315x42
By writing the four English letters “PNMK” on white paper with a marker pen, and then scanning with a DESI ion source to obtain the scanning result. The signal of the chemical substances on the marker pen used appears on the channel with an m/z value of |
|
| 271.2284 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_3 - MTBLS385Resolution: 75μm, 121x68
|
|
| 271.2272 | [M+H]+PPM:1.6 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_4 - MTBLS385Resolution: 17μm, 82x80
|
|
| 271.2281 | [M+H]+PPM:4.9 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_2 - MTBLS385Resolution: 17μm, 95x101
|
|
| 271.2277 | [M+H]+PPM:3.5 |
Homo sapiens | esophagus | DESI () |
TO42T - MTBLS385Resolution: 17μm, 69x81
|
|
| 271.2287 | [M+H]+PPM:7.2 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_9 - MTBLS385Resolution: 75μm, 89x74
|
|
| 271.2278 | [M+H]+PPM:3.8 |
Homo sapiens | esophagus | DESI () |
TO39T - MTBLS385Resolution: 17μm, 69x81
|
|
| 271.2275 | [M+H]+PPM:2.7 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
80TopL, 50TopR, 70BottomL, 60BottomR-profile - MTBLS415Resolution: 17μm, 137x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 271.2282 | [M+H]+PPM:5.3 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
520TopL, 490TopR, 510BottomL, 500BottomR-profile - MTBLS415Resolution: 17μm, 147x131
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 271.2279 | [M+H]+PPM:4.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
439TopL, 409TopR, 429BottomL, 419BottomR-profile - MTBLS415Resolution: 17μm, 157x136
The human colorectal adenocarcinoma sample was excised during a surgical operation performed at the Imperial College Healthcare NHS Trust. The sample and procedures were carried out in accordance with ethical approval (14/EE/0024). |
|
| 271.2282 | [M+H]+PPM:5.3 |
Homo sapiens | NA | DESI () |
160TopL,130TopR,150BottomL,140BottomR-profile - MTBLS415Resolution: 17μm, 142x136
|
|
| 271.2279 | [M+H]+PPM:4.2 |
Homo sapiens | esophagus | DESI () |
LNTO29_16_3 - MTBLS385Resolution: 17μm, 108x107
|
|
| 271.2284 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_1 - MTBLS385Resolution: 17μm, 75x74
|
|
| 271.2287 | [M+H]+PPM:7.2 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_2 - MTBLS385Resolution: 17μm, 135x101
|
|
| 271.2283 | [M+H]+PPM:5.7 |
Homo sapiens | esophagus | DESI () |
LNTO26_7_3 - MTBLS385Resolution: 75μm, 82x88
|
|
| 271.228 | [M+H]+PPM:4.6 |
Homo sapiens | esophagus | DESI () |
TO31T - MTBLS385Resolution: 75μm, 56x54
|
|
| 271.2284 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
TO29T - MTBLS385Resolution: 75μm, 56x48
|
|
| 271.2279 | [M+H]+PPM:4.2 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_3 - MTBLS385Resolution: 75μm, 69x54
|
|
| 271.2281 | [M+H]+PPM:4.9 |
Homo sapiens | esophagus | DESI () |
LNTO30_8M_5 - MTBLS385Resolution: 75μm, 56x54
|
|
| 271.2281 | [M+H]+PPM:4.9 |
Homo sapiens | esophagus | DESI () |
LNTO30_17_2 - MTBLS385Resolution: 75μm, 82x54
|
|
| 271.2285 | [M+H]+PPM:6.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_5 - MTBLS385Resolution: 75μm, 135x94
|
|
| 271.2285 | [M+H]+PPM:6.4 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_7 - MTBLS385Resolution: 75μm, 69x54
|
|
| 271.2283 | [M+H]+PPM:5.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_1_8 - MTBLS385Resolution: 75μm, 69x61
|
|
| 271.2283 | [M+H]+PPM:5.7 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_1 - MTBLS385Resolution: 75μm, 89x88
|
|
| 271.2289 | [M+H]+PPM:7.9 |
Homo sapiens | esophagus | DESI () |
LNTO22_2_2 - MTBLS385Resolution: 75μm, 135x94
|
|
| 271.2284 | [M+H]+PPM:6 |
Homo sapiens | esophagus | DESI () |
LNTO26_16_1 - MTBLS385Resolution: 75μm, 95x88
|
|
| 271.2279 | [M+H]+PPM:4.2 |
Homo sapiens | esophagus | DESI () |
LNTO29_18_2 - MTBLS385Resolution: 75μm, 62x68
|
|
| 271.228 | [M+H]+PPM:4.6 |
Homo sapiens | esophagus | DESI () |
LNTO30_7_2 - MTBLS385Resolution: 75μm, 82x68
|
|
| 271.2278 | [M+H]+PPM:3.8 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
240TopL, 210TopR, 230BottomL, 220BottomR-centroid - MTBLS176Resolution: 50μm, 142x141
|
|
| 271.228 | [M+H]+PPM:4.6 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
200TopL, 170TopR, 190BottomL, 180BottomR-centroid - MTBLS176Resolution: 50μm, 132x126
|
|
| 271.2277 | [M+H]+PPM:3.5 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
160TopL,130TopR,150BottomL,140BottomR-centroid - MTBLS176Resolution: 50μm, 142x136
|
|
| 271.2279 | [M+H]+PPM:4.2 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
11-Oxohexadecanoic acid is found in milk and milk products. 11-Oxohexadecanoic acid is a trace constituent of milk fa Trace constituent of milk fat. 11-Oxohexadecanoic acid is found in milk and milk products.
