Gomphidic acid
Formula: C18H12O9 (372.0481)
Chinese Name:
BioDeep ID: BioDeep_00000019833
( View LC/MS Profile)
SMILES: C1=CC(=CC=C1C(=C2C(=C(C(=O)O2)C3=CC(=C(C(=C3)O)O)O)O)C(=O)O)O
Found 3 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
373.0579 | [M+H]+PPM:6.7 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma1-42_03 - MTBLS313Resolution: 17μm, 483x403
|
|
373.0579 | [M+H]+PPM:6.7 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-3-88 - MTBLS313Resolution: 17μm, 288x282
|
|
373.0579 | [M+H]+PPM:6.7 |
Mus musculus | brain | MALDI (DHB) |
Brain02_Bregma-1-46 - MTBLS313Resolution: 17μm, 294x399
|
|
Gomphidic acid is found in mushrooms. Gomphidic acid is a pigment from the lichen Gomphidius glutinosus (spike cap). Pigment from the lichen Gomphidius glutinosus (spike cap). Gomphidic acid is found in mushrooms.