Bipindogulomethyloside
Formula: C29H44O10 (552.2934)
Chinese Name: 比皮德苷
BioDeep ID: BioDeep_00000007013
( View LC/MS Profile)
SMILES: CC1C(C(C(C(O1)OC2CCC3(C4C(CCC3(C2)O)C5(CCC(C5(CC4O)C)C6=CC(=O)OC6)O)C)O)O)O
Found 11 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 570.3322 | [M+NH4]+PPM:8.7 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_18 - MTBLS58Resolution: 17μm, 208x104
|
|
| 553.3098 | [M+H]+PPM:16.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 570.3321 | [M+NH4]+PPM:17.3 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito08_48 - MTBLS58Resolution: 17μm, 294x107
|
|
| 535.2992 | [M+H-H2O]+PPM:16.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 552.3064 | [M-H2O+NH4]+PPM:18.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 570.3372 | [M+NH4]+PPM:17.4 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito01_04 - MTBLS58Resolution: 17μm, 178x91
|
|
| 535.2992 | [M+H-H2O]+PPM:16.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 552.3065 | [M-H2O+NH4]+PPM:18.5 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 553.3099 | [M+H]+PPM:16.6 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 570.3363 | [M+NH4]+PPM:15.9 |
Rattus norvegicus | Epididymis | MALDI (DHB) |
epik_dhb_head_ito03_14 - MTBLS58Resolution: 17μm, 205x103
|
|
| 570.3166 | [M+NH4]+PPM:18.7 |
Mus musculus | Lung | MALDI (DHB) |
image1 - MTBLS2075Resolution: 40μm, 187x165
Fig. 2 MALDI-MSI data from the same mouse lung tissue analyzed in Fig. 1. A: Optical image of the post-MSI, H&E-stained tissue section. B–D, F–G: Ion images of (B) m/z 796.6855 ([U13C-DPPC+Na]+), (C) m/z 756.5514 ([PC32:0+Na]+), (D) m/z 765.6079 ([D9-PC32:0+Na]+), (F) m/z 754.5359 ([PC32:1+Na]+), and (G) m/z 763.5923 ([D9-PC32:1+Na]+). E, H: Ratio images of (E) [D9-PC32:0+Na]+:[PC32:0+Na]+ and (H) [D9-PC32:1+Na]+:[PC32:1+Na]+. Part-per-million (ppm) mass errors are indicated in parentheses. All images were visualized using total-ion-current normalization and using hotspot removal (high quantile = 99%). DPPC = PC16:0/16:0. U13C-DPPC, universally 13C-labeled dipalmitoyl PC; PC, phosphatidylcholine; MSI, mass spectrometry imaging; H&E, hematoxylin and eosin.
Fig 1-3, Fig S1-S3, S5 |
|
Bipindogulomethyloside is isolated from Convallaria majalis. Convallaria majalis is banned by the FDA from food use in the US Isolated from Convallaria majalis. Convallaria majalis is banned by the FDA from food use in the USA.
