6'-O-Malonyldaidzin
Formula: C24H22O12 (502.1111)
Chinese Name: 6-O-丙二酰基大豆苷
BioDeep ID: BioDeep_00000004069
( View LC/MS Profile)
SMILES: c1(ccc2c(c1)occ(c2=O)c1ccc(cc1)O)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)CC(=O)O)O)O)O
Found 8 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 520.1446 | [M+NH4]+PPM:0.7 |
Mus musculus | Kidney | MALDI (CHCA) |
FULL_MS_centriod_CHCA_20210819 - FULL_MS_centriod_CHCA_20210819Resolution: 17μm, 638x437
AP-MALDI instrument demo test, mass spectrum scan in centroid mode. |
|
| 485.1056 | [M+H-H2O]+PPM:4.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 502.1249 | [M-H2O+NH4]+PPM:18.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 520.1354 | [M+NH4]+PPM:18.4 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 502.1249 | [M-H2O+NH4]+PPM:18.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
| 502.125 | [M-H2O+NH4]+PPM:18.7 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
| 520.1355 | [M+NH4]+PPM:18.2 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
| 485.107 | [M+H-H2O]+PPM:1.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
Present in soy foods; potential nutriceutical. 6-Malonyldaidzin is found in many foods, some of which are soy milk, soy sauce, soy bean, and soy yogurt. 6-O-Malonyldaidzin is found in miso. 6-O-Malonyldaidzin is present in soy foods; potential nutriceutical.
