5,21-dibromo-3-[3,4-dihydroxy-6-(hydroxymethyl)-5-methoxyoxan-2-yl]-14-hydroxy-3,13,23-triazahexacyclo[14.7.0.0²,¹⁰.0⁴,⁹.0¹¹,¹⁵.0¹⁷,²²]tricosa-1(16),2(10),4(9),5,7,11(15),13,17(22),18,20-decaen-12-one
Formula: C27H21Br2N3O7 (656.9746)
Chinese Name:
BioDeep ID: BioDeep_00002182715
( View LC/MS Profile)
SMILES: COC1C(CO)OC(n2c3c(Br)cccc3c3c4c(c5c6cccc(Br)c6[nH]c5c32)C(O)=NC4=O)C(O)C1O
Found 14 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
639.9806 | [M+H-H2O]+PPM:14.5 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
656.9849 | [M]+PPM:16.5 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
656.9971 | [M-H2O+NH4]+PPM:1.2 |
Mus musculus | Urinary bladder | MALDI (CHCA) |
HR2MSI_mouse_urinary_bladder - S096 - PXD001283Resolution: 10μm, 260x134
Mass spectrometry imaging of phospholipids in mouse urinary bladder (imzML dataset) |
|
675.0105 | [M+NH4]+PPM:3.1 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
657.0051 | [M-H2O+NH4]+PPM:11 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
675.0104 | [M+NH4]+PPM:2.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
675.0105 | [M+NH4]+PPM:3.1 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
675.0128 | [M+NH4]+PPM:6.5 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
679.9644 | [M+Na]+PPM:0.8 |
Mytilus edulis | mantle | MALDI (DHB) |
20190201_MS38_Crassostrea_Mantle_350-1500_DHB_pos_A28_10um_270x210 - MTBLS2960Resolution: 10μm, 270x210
|
|
675.012 | [M+NH4]+PPM:5.3 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
679.9638 | [M+Na]+PPM:0.1 |
Mytilus edulis | gill | MALDI (DHB) |
20190202_MS38_Crassostrea_Gill_350-1500_DHB_pos_A25_11um_305x210 - MTBLS2960Resolution: 11μm, 305x210
single cell layer |
|
656.9857 | [M]+PPM:17.7 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
675.0122 | [M+NH4]+PPM:5.6 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|
679.9637 | [M+Na]+PPM:0.2 |
Mytilus edulis | mantle | MALDI (DHB) |
20190216_MS38_Mytilus_mantle_350-1500_DHB_pos_A26_10um_275x210 - MTBLS2960Resolution: 10μm, 275x210
|
|