Glycosmisic acid sulfate
Formula: C20H20O10S (452.0777)
Chinese Name:
BioDeep ID: BioDeep_00001038024
( View LC/MS Profile)
SMILES: COC1=CC(=CC2=C1OC(C2COS(=O)(=O)O)C3=CC(=C(C=C3)O)OC)C=CC(=O)O
Found 6 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 417.0564 | [M+H-2H2O]+PPM:17.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 435.0688 | [M+H-H2O]+PPM:12.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 453.0793 | [M+H]+PPM:12.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 475.0613 | [M+Na]+PPM:11.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 417.0583 | [M+H-2H2O]+PPM:13.3 |
Posidonia oceanica | root | MALDI (CHCA) |
MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
|
|
| 470.1197 | [M+NH4]+PPM:17.4 |
Posidonia oceanica | root | MALDI (CHCA) |
MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
|
|
A guaiacyl lignin that is glycosmisic acid in which the alcoholic hydrogen is replaced by a sulfo group.
