Chebulic_acid
                        Formula: C14H12O11 (356.038)
                        
                        Chinese Name:  诃子次酸
                        BioDeep ID: BioDeep_00000396672 
                        ( View LC/MS Profile)
                        SMILES:  C1=C2C(=C(C(=C1O)O)O)C(C(OC2=O)C(=O)O)C(CC(=O)O)C(=O)O
                    
Found 9 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 339.0284 | [M+H-H2O]+PPM:18.5 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
                                             Grape berries fruit, condition: Ripe  | 
                                    
                                        
                                             | 
                                
| 357.0407 | [M+H]+PPM:12.7 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
                                             Grape berries fruit, condition: Ripe  | 
                                    
                                        
                                             | 
                                
| 339.0284 | [M+H-H2O]+PPM:18.5 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 356.0319 | [M]+PPM:15.5 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 357.0407 | [M+H]+PPM:12.7 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 339.0282 | [M+H-H2O]+PPM:19.1 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 356.0321 | [M]+PPM:14.9 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 357.0407 | [M+H]+PPM:12.7 | 
                                    Vitis vinifera | Fruit | MALDI (DHB) | 
                                        grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
                                             Grape berries fruit, condition: Late  | 
                                    
                                        
                                             | 
                                
| 379.033 | [M+Na]+PPM:15.4 | 
                                    Posidonia oceanica | root | MALDI (CHCA) | 
                                        MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
                                              | 
                                    
                                        
                                             | 
                                
Chebulic acid is a natural product found in Terminalia chebula, Terminalia citrina, and Phyllanthus emblica with data available. Chebulic acid, a phenolcarboxylic acid compound isolated from Terminalia chebula, has potent anti-oxidant activity, which breaks the cross-links of proteins induced by advanced glycation end-products (AGEs) and inhibits the formation of AGEs. Chebulic acid is effective in controlling elevated metabolic parameters, oxidative stress and renal damage, supporting its beneficial effect in diabetic nephropathy[1][2]. Chebulic acid, a phenolcarboxylic acid compound isolated from Terminalia chebula, has potent anti-oxidant activity, which breaks the cross-links of proteins induced by advanced glycation end-products (AGEs) and inhibits the formation of AGEs. Chebulic acid is effective in controlling elevated metabolic parameters, oxidative stress and renal damage, supporting its beneficial effect in diabetic nephropathy[1][2].
