bromophycolide A
Formula: C27H37Br3O4 (662.0242)
Chinese Name:
BioDeep ID: BioDeep_00000382467
( View LC/MS Profile)
SMILES: CC1=C2CC3=C(C=CC(=C3)C(=O)OC(CCC(C(CCC2(C(CC1)Br)C)Br)(C)O)C(C)(C)Br)O
Found 8 Sample Hits
| m/z | Adducts | Species | Organ | Scanning | Sample | |
|---|---|---|---|---|---|---|
| 645.031 | [M+H-H2O]+PPM:15.7 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 662.0551 | [M-H2O+NH4]+PPM:11.6 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 663.0338 | [M+H]+PPM:3.5 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
| 662.0548 | [M-H2O+NH4]+PPM:11.1 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
| 663.0338 | [M+H]+PPM:3.5 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
| 645.0226 | [M+H-H2O]+PPM:2.7 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
| 662.0549 | [M-H2O+NH4]+PPM:11.3 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
| 663.0338 | [M+H]+PPM:3.5 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
A diterpenoid that is a macrolide isolated from the Fijian red alga Callophycus serratus. It has been found to exhibit moderate cytotoxicity against several human tumour cell lines via specific apotopic cell death. It also displays anti-HIV, antibacterial, antifungal and antimalarial activity.
