Arginyltryptophan
Formula: C17H24N6O3 (360.191)
Chinese Name:
BioDeep ID: BioDeep_00000027007
( View LC/MS Profile)
SMILES: N[C@@H](CCCNC(N)=N)C(=O)N[C@@H](CC1=CNC2=C1C=CC=C2)C(O)=O
Found 1 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
361.1916 | [M+H]+PPM:18.4 |
Homo sapiens | colorectal adenocarcinoma | DESI () |
120TopL, 90TopR, 110BottomL, 100BottomR-centroid - MTBLS176Resolution: 50μm, 132x136
|
|
Arginyltryptophan is a dipeptide composed of arginine and tryptophan. It is an incomplete breakdown product of protein digestion or protein catabolism. Some dipeptides are known to have physiological or cell-signaling effects although most are simply short-lived intermediates on their way to specific amino acid degradation pathways following further proteolysis.