Lysylarginine
Formula: C12H26N6O3 (302.2066)
Chinese Name:
BioDeep ID: BioDeep_00000026783
( View LC/MS Profile)
SMILES: NCCCC[C@H](N)C(=O)N[C@@H](CCCNC(N)=N)C(O)=O
Found 1 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
302.2259 | [M-H2O+NH4]+PPM:13.2 |
Homo sapiens | NA | DESI () |
160TopL,130TopR,150BottomL,140BottomR-profile - MTBLS415Resolution: 17μm, 142x136
|
|
Lysylarginine is a dipeptide composed of lysine and arginine. It is an incomplete breakdown product of protein digestion or protein catabolism. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Some dipeptides are known to have physiological or cell-signalling effects although most are simply short-lived intermediates on their way to specific amino acid degradation pathways following further proteolysis.