Ginsenoside Mc
Formula: C41H70O12 (754.4867)
Chinese Name:
BioDeep ID: BioDeep_00000025858
( View LC/MS Profile)
SMILES: [H][C@@]1(CO)O[C@@]([H])(OC[C@@]2([H])O[C@@]([H])(O[C@@](C)(CCC=C(C)C)[C@@]3([H])CC[C@]4(C)[C@]3([H])[C@]([H])(O)C[C@]3([H])[C@@]5(C)CC[C@]([H])(O)C(C)(C)[C@]5([H])CC[C@@]43C)[C@]([H])(O)[C@@]([H])(O)[C@]2([H])O)[C@]([H])(O)[C@@]1([H])O
Found 3 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
719.4707 | [M+H-2H2O]+PPM:3 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
719.4706 | [M+H-2H2O]+PPM:3.1 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
719.4707 | [M+H-2H2O]+PPM:3 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
Ginsenoside Mc is considered to be practically insoluble (in water) and acidic