Knipholone
Formula: C24H18O8 (434.1002)
Chinese Name: 尼福酮
BioDeep ID: BioDeep_00000008050
( View LC/MS Profile)
SMILES: CC1=CC(=C2C(=C1C3=C(C(=C(C=C3O)OC)C(=O)C)O)C(=O)C4=C(C2=O)C(=CC=C4)O)O
Found 6 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
399.09 | [M+H-2H2O]+PPM:9.2 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
399.09 | [M+H-2H2O]+PPM:9.2 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_164_1 - Grape DatabaseResolution: 17μm, 136x122
Grape berries fruit, condition: Late |
|
399.09 | [M+H-2H2O]+PPM:9.2 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
399.0863 | [M+H-2H2O]+PPM: |
Posidonia oceanica | root | MALDI (CHCA) |
20190613_MS1_A19r-18 - MTBLS1746Resolution: 17μm, 246x264
|
|
434.0954 | [M]+PPM:9.7 |
Posidonia oceanica | root | MALDI (CHCA) |
20190613_MS1_A19r-18 - MTBLS1746Resolution: 17μm, 246x264
|
|
399.0856 | [M+H-2H2O]+PPM:1.8 |
Posidonia oceanica | root | MALDI (CHCA) |
MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
|
|
An anthraquinone that is anthracene-9,10-dione substituted by hydroxy groups at positions 4 and 6, a methyl group at position 2 and a 3-acetyl-2,6-dihydroxy-4-methoxyphenyl group at position 1. It exhibits antioxidant, cytotoxic and antiplasmodial activities.