Glucoraphenin
Formula: C12H21NO10S3 (435.0328)
Chinese Name: 染料木素苷
BioDeep ID: BioDeep_00000003555
( View LC/MS Profile)
SMILES: O[C@@H]1[C@@H]([C@H]([C@H](O[C@@H]1CO)S/C(=N\OS(=O)(=O)O)/CC/C=C/[S@@](=O)C)O)O
Found 5 Sample Hits
m/z | Adducts | Species | Organ | Scanning | Sample | |
---|---|---|---|---|---|---|
418.0315 | [M+H-H2O]+PPM:4.9 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_91_1 - Grape DatabaseResolution: 50μm, 120x114
Grape berries fruit, condition: Ripe |
|
418.0313 | [M+H-H2O]+PPM:4.4 |
Vitis vinifera | Fruit | MALDI (DHB) |
grape_dhb_163_1 - Grape DatabaseResolution: 17μm, 132x115
Grape berries fruit, condition: Late |
|
435.0479 | [M-H2O+NH4]+PPM:18.7 |
Posidonia oceanica | root | MALDI (CHCA) |
20190613_MS1_A19r-18 - MTBLS1746Resolution: 17μm, 246x264
|
|
435.0474 | [M-H2O+NH4]+PPM:19.8 |
Posidonia oceanica | root | MALDI (CHCA) |
MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
|
|
453.0582 | [M+NH4]+PPM:18.5 |
Posidonia oceanica | root | MALDI (CHCA) |
MS1_20180404_PO_1200 - MTBLS1746Resolution: 17μm, 193x208
|
|
Acquisition and generation of the data is financially supported in part by CREST/JST.